C19H27N7O2S — CID 121267556
N-(5-cyanopentyl)-N-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide (PubChem CID 121267556) has the molecular formula C19H27N7O2S and a molecular weight of 417.54 g/mol. Its IUPAC name is N-(5-cyanopentyl)-N-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide.
| Compound Name | N-(5-cyanopentyl)-N-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide |
|---|---|
| PubChem CID | 121267556 |
| Molecular Formula | C19H27N7O2S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-(5-cyanopentyl)-N-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-4,7-diazaspiro[2.5]octane-4-sulfonamide |
| SMILES | CN(CCCCCC#N)S(=O)(=O)N1CCN(c2ncnc3[nH]ccc23)CC12CC2 |
| InChI | InChI=1S/C19H27N7O2S/c1-24(11-5-3-2-4-9-20)29(27,28)26-13-12-25(14-19(26)7-8-19)18-16-6-10-21-17(16)22-15-23-18/h6,10,15H,2-5,7-8,11-14H2,1H3,(H,21,22,23) |
| InChIKey | JMOFPFXBLQATTK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|