C33H33NO6S2 — CID 121268294
(3R)-3-[6-[[3-[4-[(1,1-dioxothian-4-yl)methoxy]-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid (PubChem CID 121268294) has the molecular formula C33H33NO6S2 and a molecular weight of 603.76 g/mol. Its IUPAC name is (3R)-3-[6-[[3-[4-[(1,1-dioxothian-4-yl)methoxy]-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid.
| Compound Name | (3R)-3-[6-[[3-[4-[(1,1-dioxothian-4-yl)methoxy]-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 121268294 |
| Molecular Formula | C33H33NO6S2 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | (3R)-3-[6-[[3-[4-[(1,1-dioxothian-4-yl)methoxy]-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(OCC5CCS(=O)(=O)CC5)cc4C)c3c2)nc1 |
| InChI | InChI=1S/C33H33NO6S2/c1-3-4-25(17-33(35)36)26-6-10-32(34-18-26)40-20-24-5-9-31-29(16-24)30(21-41-31)28-8-7-27(15-22(28)2)39-19-23-11-13-42(37,38)14-12-23/h5-10,15-16,18,21,23,25H,11-14,17,19-20H2,1-2H3,(H,35,36)/t25-/m0/s1 |
| InChIKey | OLVITPRGQZLQIF-VWLOTQADSA-N |
| XLogP | 6.64 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|