C30H29NO6S — CID 121268333
3-[6-[[3-[4-(2,3-dihydroxypropoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid (PubChem CID 121268333) has the molecular formula C30H29NO6S and a molecular weight of 531.63 g/mol. Its IUPAC name is 3-[6-[[3-[4-(2,3-dihydroxypropoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid.
| Compound Name | 3-[6-[[3-[4-(2,3-dihydroxypropoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 121268333 |
| Molecular Formula | C30H29NO6S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 3-[6-[[3-[4-(2,3-dihydroxypropoxy)-2-methylphenyl]-1-benzothiophen-5-yl]methoxy]-3-pyridinyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc3scc(-c4ccc(OCC(O)CO)cc4C)c3c2)nc1 |
| InChI | InChI=1S/C30H29NO6S/c1-3-4-21(13-30(34)35)22-6-10-29(31-14-22)37-16-20-5-9-28-26(12-20)27(18-38-28)25-8-7-24(11-19(25)2)36-17-23(33)15-32/h5-12,14,18,21,23,32-33H,13,15-17H2,1-2H3,(H,34,35) |
| InChIKey | CVZYTWWGNQXOIJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|