C8H6F2N6O — CID 121268869
6-azido-3-(difluoromethyl)-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 121268869) has the molecular formula C8H6F2N6O and a molecular weight of 240.17 g/mol. Its IUPAC name is 6-azido-3-(difluoromethyl)-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-azido-3-(difluoromethyl)-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 121268869 |
| Molecular Formula | C8H6F2N6O |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6-azido-3-(difluoromethyl)-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1cc(N=[N+]=[N-])cn2c(C(F)F)nnc12 |
| InChI | InChI=1S/C8H6F2N6O/c1-17-5-2-4(12-15-11)3-16-7(5)13-14-8(16)6(9)10/h2-3,6H,1H3 |
| InChIKey | XVXYOSPLFQFODM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 88.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|