C12H8BrF2N — CID 121269348
3-[(4-bromo-2,6-difluorophenyl)methyl]pyridine (PubChem CID 121269348) has the molecular formula C12H8BrF2N and a molecular weight of 284.10 g/mol. Its IUPAC name is 3-[(4-bromo-2,6-difluorophenyl)methyl]pyridine.
| Compound Name | 3-[(4-bromo-2,6-difluorophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 121269348 |
| Molecular Formula | C12H8BrF2N |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 3-[(4-bromo-2,6-difluorophenyl)methyl]pyridine |
| SMILES | Fc1cc(Br)cc(F)c1Cc1cccnc1 |
| InChI | InChI=1S/C12H8BrF2N/c13-9-5-11(14)10(12(15)6-9)4-8-2-1-3-16-7-8/h1-3,5-7H,4H2 |
| InChIKey | XIPGVEACOCUVEJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |