C25H25NO5 — CID 121269382
(E)-6-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]hex-2-enoic acid (PubChem CID 121269382) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is (E)-6-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]hex-2-enoic acid.
| Compound Name | (E)-6-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]hex-2-enoic acid |
|---|---|
| PubChem CID | 121269382 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (E)-6-[2-[[[4-(furan-2-yl)benzoyl]-methylamino]methyl]phenoxy]hex-2-enoic acid |
| SMILES | CN(Cc1ccccc1OCCC/C=C/C(=O)O)C(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C25H25NO5/c1-26(25(29)20-14-12-19(13-15-20)22-10-7-17-31-22)18-21-8-4-5-9-23(21)30-16-6-2-3-11-24(27)28/h3-5,7-15,17H,2,6,16,18H2,1H3,(H,27,28)/b11-3+ |
| InChIKey | PRLUQZAEJIZRCO-QDEBKDIKSA-N |
| XLogP | 5.02 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|