About N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine
N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine (PubChem CID 121271668) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine |
| PubChem CID | 121271668 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine |
| SMILES | CN(C)C1CC=CCO1 |
| InChI | InChI=1S/C7H13NO/c1-8(2)7-5-3-4-6-9-7/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | IVHDIBBOMUYCIT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine?
The IUPAC name of N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine (CID 121271668) is N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine.
What is the SMILES notation for N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine?
The canonical SMILES for N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine is CN(C)C1CC=CCO1.
What is the InChIKey of N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine?
The InChIKey is IVHDIBBOMUYCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-8(2)7-5-3-4-6-9-7/h3-4,7H,5-6H2,1-2H3.
What are the key properties of N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine?
N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine has a molecular weight of 127.19 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3,6-dihydro-2H-pyran-2-amine is sourced from PubChem (CID 121271668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).