C20H23N7O3 — CID 121271873
N-[5-[6-cyano-5-[[(2R,3S)-2-(dimethylamino)-3-hydroxy-1-oxobutan-2-yl]amino]-3-pyridinyl]pyrazin-2-yl]cyclopropanecarboxamide (PubChem CID 121271873) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[5-[6-cyano-5-[[(2R,3S)-2-(dimethylamino)-3-hydroxy-1-oxobutan-2-yl]amino]-3-pyridinyl]pyrazin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[6-cyano-5-[[(2R,3S)-2-(dimethylamino)-3-hydroxy-1-oxobutan-2-yl]amino]-3-pyridinyl]pyrazin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 121271873 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[5-[6-cyano-5-[[(2R,3S)-2-(dimethylamino)-3-hydroxy-1-oxobutan-2-yl]amino]-3-pyridinyl]pyrazin-2-yl]cyclopropanecarboxamide |
| SMILES | C[C@H](O)[C@@](C=O)(Nc1cc(-c2cnc(NC(=O)C3CC3)cn2)cnc1C#N)N(C)C |
| InChI | InChI=1S/C20H23N7O3/c1-12(29)20(11-28,27(2)3)26-15-6-14(8-22-16(15)7-21)17-9-24-18(10-23-17)25-19(30)13-4-5-13/h6,8-13,26,29H,4-5H2,1-3H3,(H,24,25,30)/t12-,20-/m0/s1 |
| InChIKey | LVRJXLHIGUASNI-YUNKPMOVSA-N |
| XLogP | 1.01 |
| TPSA | 144.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|