C24H25ClN6O2 — CID 121272119
N-(4-chlorophenyl)-6-[1-(2-methoxyethyl)indazol-6-yl]-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 121272119) has the molecular formula C24H25ClN6O2 and a molecular weight of 464.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-[1-(2-methoxyethyl)indazol-6-yl]-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-(4-chlorophenyl)-6-[1-(2-methoxyethyl)indazol-6-yl]-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 121272119 |
| Molecular Formula | C24H25ClN6O2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-(4-chlorophenyl)-6-[1-(2-methoxyethyl)indazol-6-yl]-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | COCCn1ncc2ccc(-c3cc(Nc4ccc(Cl)cc4)nc(N4CCOCC4)n3)cc21 |
| InChI | InChI=1S/C24H25ClN6O2/c1-32-11-10-31-22-14-17(2-3-18(22)16-26-31)21-15-23(27-20-6-4-19(25)5-7-20)29-24(28-21)30-8-12-33-13-9-30/h2-7,14-16H,8-13H2,1H3,(H,27,28,29) |
| InChIKey | IUTUNEIMWMDXAP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |