About methyl 5-nitrohex-3-ynoate
methyl 5-nitrohex-3-ynoate (PubChem CID 121272473) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is methyl 5-nitrohex-3-ynoate.
Molecular Properties
| Compound Name | methyl 5-nitrohex-3-ynoate |
| PubChem CID | 121272473 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | methyl 5-nitrohex-3-ynoate |
| SMILES | COC(=O)CC#CC(C)[N+](=O)[O-] |
| InChI | InChI=1S/C7H9NO4/c1-6(8(10)11)4-3-5-7(9)12-2/h6H,5H2,1-2H3 |
| InChIKey | ANAHKHQLBZDIOB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-nitrohex-3-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-nitrohex-3-ynoate?
The IUPAC name of methyl 5-nitrohex-3-ynoate (CID 121272473) is methyl 5-nitrohex-3-ynoate.
What is the SMILES notation for methyl 5-nitrohex-3-ynoate?
The canonical SMILES for methyl 5-nitrohex-3-ynoate is COC(=O)CC#CC(C)[N+](=O)[O-].
What is the InChIKey of methyl 5-nitrohex-3-ynoate?
The InChIKey is ANAHKHQLBZDIOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-6(8(10)11)4-3-5-7(9)12-2/h6H,5H2,1-2H3.
What are the key properties of methyl 5-nitrohex-3-ynoate?
methyl 5-nitrohex-3-ynoate has a molecular weight of 171.15 g/mol, XLogP of 0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-nitrohex-3-ynoate is sourced from PubChem (CID 121272473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).