About (3R,4S)-4-methylhept-5-yne-3,4-diol
(3R,4S)-4-methylhept-5-yne-3,4-diol (PubChem CID 121273235) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is (3R,4S)-4-methylhept-5-yne-3,4-diol.
Molecular Properties
| Compound Name | (3R,4S)-4-methylhept-5-yne-3,4-diol |
| PubChem CID | 121273235 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (3R,4S)-4-methylhept-5-yne-3,4-diol |
| SMILES | CC#C[C@](C)(O)[C@H](O)CC |
| InChI | InChI=1S/C8H14O2/c1-4-6-8(3,10)7(9)5-2/h7,9-10H,5H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | HOMFMTUEWBGOLK-SFYZADRCSA-N |
| XLogP | 0.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-4-methylhept-5-yne-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-methylhept-5-yne-3,4-diol?
The IUPAC name of (3R,4S)-4-methylhept-5-yne-3,4-diol (CID 121273235) is (3R,4S)-4-methylhept-5-yne-3,4-diol.
What is the SMILES notation for (3R,4S)-4-methylhept-5-yne-3,4-diol?
The canonical SMILES for (3R,4S)-4-methylhept-5-yne-3,4-diol is CC#C[C@](C)(O)[C@H](O)CC.
What is the InChIKey of (3R,4S)-4-methylhept-5-yne-3,4-diol?
The InChIKey is HOMFMTUEWBGOLK-SFYZADRCSA-N. The full InChI is InChI=1S/C8H14O2/c1-4-6-8(3,10)7(9)5-2/h7,9-10H,5H2,1-3H3/t7-,8+/m1/s1.
What are the key properties of (3R,4S)-4-methylhept-5-yne-3,4-diol?
(3R,4S)-4-methylhept-5-yne-3,4-diol has a molecular weight of 142.20 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-methylhept-5-yne-3,4-diol is sourced from PubChem (CID 121273235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).