C8H11Cl2F3 — CID 121273904
1,1-dichloro-2,2-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane (PubChem CID 121273904) has the molecular formula C8H11Cl2F3 and a molecular weight of 235.08 g/mol. Its IUPAC name is 1,1-dichloro-2,2-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane.
| Compound Name | 1,1-dichloro-2,2-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 121273904 |
| Molecular Formula | C8H11Cl2F3 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 1,1-dichloro-2,2-dimethyl-3-(1,1,1-trifluoropropan-2-yl)cyclopropane |
| SMILES | CC(C1C(C)(C)C1(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C8H11Cl2F3/c1-4(8(11,12)13)5-6(2,3)7(5,9)10/h4-5H,1-3H3 |
| InChIKey | XAMIZPMSPFGUAG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|