C7H8Cl3F3 — CID 121273991
1,1,3-trichloro-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane (PubChem CID 121273991) has the molecular formula C7H8Cl3F3 and a molecular weight of 255.49 g/mol. Its IUPAC name is 1,1,3-trichloro-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane.
| Compound Name | 1,1,3-trichloro-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 121273991 |
| Molecular Formula | C7H8Cl3F3 |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 1,1,3-trichloro-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane |
| SMILES | CC(C(F)(F)F)C1(C)C(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C7H8Cl3F3/c1-3(7(11,12)13)5(2)4(8)6(5,9)10/h3-4H,1-2H3 |
| InChIKey | CQHREKVNUJBYKF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|