C7H9Br2F3 — CID 121273998
1,1-dibromo-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane (PubChem CID 121273998) has the molecular formula C7H9Br2F3 and a molecular weight of 309.95 g/mol. Its IUPAC name is 1,1-dibromo-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane.
| Compound Name | 1,1-dibromo-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 121273998 |
| Molecular Formula | C7H9Br2F3 |
| Molecular Weight | 309.95 g/mol |
| Exact Mass | 307.90 |
| IUPAC Name | 1,1-dibromo-2-methyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane |
| SMILES | CC(C(F)(F)F)C1(C)CC1(Br)Br |
| InChI | InChI=1S/C7H9Br2F3/c1-4(7(10,11)12)5(2)3-6(5,8)9/h4H,3H2,1-2H3 |
| InChIKey | BYSFHHKVNXAITM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.95 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|