C9H14ClF3 — CID 121274002
3-chloro-1,1,2-trimethyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane (PubChem CID 121274002) has the molecular formula C9H14ClF3 and a molecular weight of 214.66 g/mol. Its IUPAC name is 3-chloro-1,1,2-trimethyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane.
| Compound Name | 3-chloro-1,1,2-trimethyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 121274002 |
| Molecular Formula | C9H14ClF3 |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-chloro-1,1,2-trimethyl-2-(1,1,1-trifluoropropan-2-yl)cyclopropane |
| SMILES | CC(C(F)(F)F)C1(C)C(Cl)C1(C)C |
| InChI | InChI=1S/C9H14ClF3/c1-5(9(11,12)13)8(4)6(10)7(8,2)3/h5-6H,1-4H3 |
| InChIKey | XYUPRLPDEJMEHT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|