About 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane
1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane (PubChem CID 121274032) has the molecular formula C8H11F5
and a molecular weight of 202.17 g/mol. Its IUPAC name is 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane.
Molecular Properties
| Compound Name | 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane |
| PubChem CID | 121274032 |
| Molecular Formula | C8H11F5 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane |
| SMILES | CCC1(C(F)(F)F)C(C)(C)C1(F)F |
| InChI | InChI=1S/C8H11F5/c1-4-6(8(11,12)13)5(2,3)7(6,9)10/h4H2,1-3H3 |
| InChIKey | FVKJSYKZIMDXIF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane?
The IUPAC name of 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane (CID 121274032) is 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane.
What is the SMILES notation for 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane?
The canonical SMILES for 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane is CCC1(C(F)(F)F)C(C)(C)C1(F)F.
What is the InChIKey of 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane?
The InChIKey is FVKJSYKZIMDXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F5/c1-4-6(8(11,12)13)5(2,3)7(6,9)10/h4H2,1-3H3.
What are the key properties of 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane?
1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane has a molecular weight of 202.17 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,2-difluoro-3,3-dimethyl-1-(trifluoromethyl)cyclopropane is sourced from PubChem (CID 121274032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).