C19H33N3O6 — CID 121274318
(6R,8R,8aS)-6-[[(3S,4S,6S)-5-azido-3,4,6-trimethyloxan-2-yl]methoxy]-2,2,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 121274318) has the molecular formula C19H33N3O6 and a molecular weight of 399.49 g/mol. Its IUPAC name is (6R,8R,8aS)-6-[[(3S,4S,6S)-5-azido-3,4,6-trimethyloxan-2-yl]methoxy]-2,2,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6R,8R,8aS)-6-[[(3S,4S,6S)-5-azido-3,4,6-trimethyloxan-2-yl]methoxy]-2,2,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 121274318 |
| Molecular Formula | C19H33N3O6 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (6R,8R,8aS)-6-[[(3S,4S,6S)-5-azido-3,4,6-trimethyloxan-2-yl]methoxy]-2,2,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CC1[C@H](OCC2O[C@@H](C)C(N=[N+]=[N-])[C@@H](C)[C@@H]2C)OC2COC(C)(C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C19H33N3O6/c1-9-10(2)15(21-22-20)12(4)26-13(9)7-24-18-11(3)16(23)17-14(27-18)8-25-19(5,6)28-17/h9-18,23H,7-8H2,1-6H3/t9-,10-,11?,12-,13?,14?,15?,16+,17+,18+/m0/s1 |
| InChIKey | FZTIXDHSBJEFSY-DHDPFQQKSA-N |
| XLogP | 2.61 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|