C23H3F15 — CID 121274455
1,2,3,4,5,6,8-heptafluoro-7-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]naphthalene (PubChem CID 121274455) has the molecular formula C23H3F15 and a molecular weight of 564.25 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptafluoro-7-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]naphthalene.
| Compound Name | 1,2,3,4,5,6,8-heptafluoro-7-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]naphthalene |
|---|---|
| PubChem CID | 121274455 |
| Molecular Formula | C23H3F15 |
| Molecular Weight | 564.25 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 1,2,3,4,5,6,8-heptafluoro-7-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]naphthalene |
| SMILES | Cc1c(F)c(F)c(-c2c(F)c(F)c(-c3c(F)c(F)c4c(F)c(F)c(F)c(F)c4c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C23H3F15/c1-2-9(24)12(27)7(13(28)10(2)25)8-18(33)15(30)5(16(31)19(8)34)3-11(26)4-6(17(32)14(3)29)21(36)23(38)22(37)20(4)35/h1H3 |
| InChIKey | JNDRMLGVQRRULZ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.25 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|