C6H11NO2 — CID 121274560
(3S,4S)-2,5-dimethyl-3,4-dihydro-2H-pyrrole-3,4-diol (PubChem CID 121274560) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is (3S,4S)-2,5-dimethyl-3,4-dihydro-2H-pyrrole-3,4-diol.
| Compound Name | (3S,4S)-2,5-dimethyl-3,4-dihydro-2H-pyrrole-3,4-diol |
|---|---|
| PubChem CID | 121274560 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (3S,4S)-2,5-dimethyl-3,4-dihydro-2H-pyrrole-3,4-diol |
| SMILES | CC1=NC(C)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H11NO2/c1-3-5(8)6(9)4(2)7-3/h3,5-6,8-9H,1-2H3/t3?,5-,6-/m0/s1 |
| InChIKey | JZXNNJDAPIEXFI-SODBFBBFSA-N |
| XLogP | -0.43 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |