C23H22N2O — CID 121274963
(2R)-N-(3,5-diphenylphenyl)pyrrolidine-2-carboxamide (PubChem CID 121274963) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R)-N-(3,5-diphenylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(3,5-diphenylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 121274963 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2R)-N-(3,5-diphenylphenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccccc2)cc(-c2ccccc2)c1)[C@H]1CCCN1 |
| InChI | InChI=1S/C23H22N2O/c26-23(22-12-7-13-24-22)25-21-15-19(17-8-3-1-4-9-17)14-20(16-21)18-10-5-2-6-11-18/h1-6,8-11,14-16,22,24H,7,12-13H2,(H,25,26)/t22-/m1/s1 |
| InChIKey | QLQTUYJQQYAZLU-JOCHJYFZSA-N |
| XLogP | 4.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |