C21H34N2 — CID 121275266
1-[(1R)-2,4,6-trimethylcyclohexa-2,4-dien-1-yl]-3-[(1S,4R)-2,4,6-trimethylcyclohex-2-en-1-yl]imidazolidine (PubChem CID 121275266) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-[(1R)-2,4,6-trimethylcyclohexa-2,4-dien-1-yl]-3-[(1S,4R)-2,4,6-trimethylcyclohex-2-en-1-yl]imidazolidine.
| Compound Name | 1-[(1R)-2,4,6-trimethylcyclohexa-2,4-dien-1-yl]-3-[(1S,4R)-2,4,6-trimethylcyclohex-2-en-1-yl]imidazolidine |
|---|---|
| PubChem CID | 121275266 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 1-[(1R)-2,4,6-trimethylcyclohexa-2,4-dien-1-yl]-3-[(1S,4R)-2,4,6-trimethylcyclohex-2-en-1-yl]imidazolidine |
| SMILES | CC1=CC(C)[C@@H](N2CCN([C@@H]3C(C)=C[C@H](C)CC3C)C2)C(C)=C1 |
| InChI | InChI=1S/C21H34N2/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6/h9-11,15-16,19-21H,7-8,12-13H2,1-6H3/t15-,16?,19?,20+,21+/m0/s1 |
| InChIKey | KHDOAIDXNDYDRX-HGPCVQCCSA-N |
| XLogP | 4.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|