About 2-(methoxymethoxy)-1,3-dinitrosopropane
2-(methoxymethoxy)-1,3-dinitrosopropane (PubChem CID 121275584) has the molecular formula C5H10N2O4
and a molecular weight of 162.14 g/mol. Its IUPAC name is 2-(methoxymethoxy)-1,3-dinitrosopropane.
Molecular Properties
| Compound Name | 2-(methoxymethoxy)-1,3-dinitrosopropane |
| PubChem CID | 121275584 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 2-(methoxymethoxy)-1,3-dinitrosopropane |
| SMILES | COCOC(CN=O)CN=O |
| InChI | InChI=1S/C5H10N2O4/c1-10-4-11-5(2-6-8)3-7-9/h5H,2-4H2,1H3 |
| InChIKey | YMSBTMIKYNXLES-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethoxy)-1,3-dinitrosopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethoxy)-1,3-dinitrosopropane?
The IUPAC name of 2-(methoxymethoxy)-1,3-dinitrosopropane (CID 121275584) is 2-(methoxymethoxy)-1,3-dinitrosopropane.
What is the SMILES notation for 2-(methoxymethoxy)-1,3-dinitrosopropane?
The canonical SMILES for 2-(methoxymethoxy)-1,3-dinitrosopropane is COCOC(CN=O)CN=O.
What is the InChIKey of 2-(methoxymethoxy)-1,3-dinitrosopropane?
The InChIKey is YMSBTMIKYNXLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O4/c1-10-4-11-5(2-6-8)3-7-9/h5H,2-4H2,1H3.
What are the key properties of 2-(methoxymethoxy)-1,3-dinitrosopropane?
2-(methoxymethoxy)-1,3-dinitrosopropane has a molecular weight of 162.14 g/mol, XLogP of 0.51, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethoxy)-1,3-dinitrosopropane is sourced from PubChem (CID 121275584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).