About 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one
3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one (PubChem CID 121275667) has the molecular formula C22H14F2N4O
and a molecular weight of 388.38 g/mol. Its IUPAC name is 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one |
| PubChem CID | 121275667 |
| Molecular Formula | C22H14F2N4O |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1c2ccncc2ncn1Cc1c(F)cc(-c2cccc3c2C=NC3)cc1F |
| InChI | InChI=1S/C22H14F2N4O/c23-19-6-14(15-3-1-2-13-8-26-9-17(13)15)7-20(24)18(19)11-28-12-27-21-10-25-5-4-16(21)22(28)29/h1-7,9-10,12H,8,11H2 |
| InChIKey | DPXHEFVDWKJFII-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one?
The IUPAC name of 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one (CID 121275667) is 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one?
The canonical SMILES for 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one is O=c1c2ccncc2ncn1Cc1c(F)cc(-c2cccc3c2C=NC3)cc1F.
What is the InChIKey of 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one?
The InChIKey is DPXHEFVDWKJFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F2N4O/c23-19-6-14(15-3-1-2-13-8-26-9-17(13)15)7-20(24)18(19)11-28-12-27-21-10-25-5-4-16(21)22(28)29/h1-7,9-10,12H,8,11H2.
What are the key properties of 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one?
3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one has a molecular weight of 388.38 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,6-difluoro-4-(1H-isoindol-4-yl)phenyl]methyl]pyrido[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 121275667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).