C20H21N3O3S — CID 121275899
tert-butyl N-[2-(5-acetyl-2-amino-3-pyridinyl)-1-benzothiophen-5-yl]carbamate (PubChem CID 121275899) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is tert-butyl N-[2-(5-acetyl-2-amino-3-pyridinyl)-1-benzothiophen-5-yl]carbamate.
| Compound Name | tert-butyl N-[2-(5-acetyl-2-amino-3-pyridinyl)-1-benzothiophen-5-yl]carbamate |
|---|---|
| PubChem CID | 121275899 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | tert-butyl N-[2-(5-acetyl-2-amino-3-pyridinyl)-1-benzothiophen-5-yl]carbamate |
| SMILES | CC(=O)c1cnc(N)c(-c2cc3cc(NC(=O)OC(C)(C)C)ccc3s2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-11(24)13-8-15(18(21)22-10-13)17-9-12-7-14(5-6-16(12)27-17)23-19(25)26-20(2,3)4/h5-10H,1-4H3,(H2,21,22)(H,23,25) |
| InChIKey | NOKWEVQAASOUAU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |