C24H27N5O6S — CID 121276199
5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-7-one (PubChem CID 121276199) has the molecular formula C24H27N5O6S and a molecular weight of 513.58 g/mol. Its IUPAC name is 5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-7-one.
| Compound Name | 5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-7-one |
|---|---|
| PubChem CID | 121276199 |
| Molecular Formula | C24H27N5O6S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,31-tetrazatetracyclo[24.2.2.12,6.09,14]hentriaconta-1(29),2,4,6(31),9,11,13,26(30),27-nonaen-7-one |
| SMILES | CN1CCOCCOCCOc2ccccc2NC(=O)c2nc(cnc2N)-c2ccc(cc2)S1(=O)=O |
| InChI | InChI=1S/C24H27N5O6S/c1-29-10-11-33-12-13-34-14-15-35-21-5-3-2-4-19(21)28-24(30)22-23(25)26-16-20(27-22)17-6-8-18(9-7-17)36(29,31)32/h2-9,16H,10-15H2,1H3,(H2,25,26)(H,28,30) |
| InChIKey | LXUQXAQHXDJMGV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 145.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|