C25H29N5O6S — CID 121276233
5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,32-tetrazatetracyclo[24.2.2.12,6.19,13]dotriaconta-1(29),2,4,6(32),9,11,13(31),26(30),27-nonaen-7-one (PubChem CID 121276233) has the molecular formula C25H29N5O6S and a molecular weight of 527.60 g/mol. Its IUPAC name is 5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,32-tetrazatetracyclo[24.2.2.12,6.19,13]dotriaconta-1(29),2,4,6(32),9,11,13(31),26(30),27-nonaen-7-one.
| Compound Name | 5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,32-tetrazatetracyclo[24.2.2.12,6.19,13]dotriaconta-1(29),2,4,6(32),9,11,13(31),26(30),27-nonaen-7-one |
|---|---|
| PubChem CID | 121276233 |
| Molecular Formula | C25H29N5O6S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 5-amino-24-methyl-25,25-dioxo-15,18,21-trioxa-25λ6-thia-4,8,24,32-tetrazatetracyclo[24.2.2.12,6.19,13]dotriaconta-1(29),2,4,6(32),9,11,13(31),26(30),27-nonaen-7-one |
| SMILES | CN1CCOCCOCCOCc2cccc(c2)NC(=O)c2nc(cnc2N)-c2ccc(cc2)S1(=O)=O |
| InChI | InChI=1S/C25H29N5O6S/c1-30-9-10-34-11-12-35-13-14-36-17-18-3-2-4-20(15-18)28-25(31)23-24(26)27-16-22(29-23)19-5-7-21(8-6-19)37(30,32)33/h2-8,15-16H,9-14,17H2,1H3,(H2,26,27)(H,28,31) |
| InChIKey | IMAWBMOJUTYHIM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 145.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|