C28H26ClFN4O2 — CID 121276337
6-chloro-N-[5-[4-(4-cyanophenyl)-4-fluoropiperidine-1-carbonyl]-2-ethyl-4-methylphenyl]pyridine-3-carboxamide (PubChem CID 121276337) has the molecular formula C28H26ClFN4O2 and a molecular weight of 504.99 g/mol. Its IUPAC name is 6-chloro-N-[5-[4-(4-cyanophenyl)-4-fluoropiperidine-1-carbonyl]-2-ethyl-4-methylphenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[5-[4-(4-cyanophenyl)-4-fluoropiperidine-1-carbonyl]-2-ethyl-4-methylphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121276337 |
| Molecular Formula | C28H26ClFN4O2 |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 6-chloro-N-[5-[4-(4-cyanophenyl)-4-fluoropiperidine-1-carbonyl]-2-ethyl-4-methylphenyl]pyridine-3-carboxamide |
| SMILES | CCc1cc(C)c(C(=O)N2CCC(F)(c3ccc(C#N)cc3)CC2)cc1NC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C28H26ClFN4O2/c1-3-20-14-18(2)23(15-24(20)33-26(35)21-6-9-25(29)32-17-21)27(36)34-12-10-28(30,11-13-34)22-7-4-19(16-31)5-8-22/h4-9,14-15,17H,3,10-13H2,1-2H3,(H,33,35) |
| InChIKey | LQOJDRMXWWMHIN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|