About 4-(chloromethyl)-2,3-dimethoxyhexane
4-(chloromethyl)-2,3-dimethoxyhexane (PubChem CID 121276899) has the molecular formula C9H19ClO2
and a molecular weight of 194.70 g/mol. Its IUPAC name is 4-(chloromethyl)-2,3-dimethoxyhexane.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,3-dimethoxyhexane |
| PubChem CID | 121276899 |
| Molecular Formula | C9H19ClO2 |
| Molecular Weight | 194.70 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-(chloromethyl)-2,3-dimethoxyhexane |
| SMILES | CCC(CCl)C(OC)C(C)OC |
| InChI | InChI=1S/C9H19ClO2/c1-5-8(6-10)9(12-4)7(2)11-3/h7-9H,5-6H2,1-4H3 |
| InChIKey | LULCBTPDKQAXJH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,3-dimethoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,3-dimethoxyhexane?
The IUPAC name of 4-(chloromethyl)-2,3-dimethoxyhexane (CID 121276899) is 4-(chloromethyl)-2,3-dimethoxyhexane.
What is the SMILES notation for 4-(chloromethyl)-2,3-dimethoxyhexane?
The canonical SMILES for 4-(chloromethyl)-2,3-dimethoxyhexane is CCC(CCl)C(OC)C(C)OC.
What is the InChIKey of 4-(chloromethyl)-2,3-dimethoxyhexane?
The InChIKey is LULCBTPDKQAXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19ClO2/c1-5-8(6-10)9(12-4)7(2)11-3/h7-9H,5-6H2,1-4H3.
What are the key properties of 4-(chloromethyl)-2,3-dimethoxyhexane?
4-(chloromethyl)-2,3-dimethoxyhexane has a molecular weight of 194.70 g/mol, XLogP of 2.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,3-dimethoxyhexane is sourced from PubChem (CID 121276899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).