C24H27N3O3 — CID 121276926
3-[2'-amino-2-(3-methoxypropyl)-2-methylspiro[1H-indene-3,4'-5H-1,3-oxazole]-5-yl]-5-methoxybenzonitrile (PubChem CID 121276926) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-[2'-amino-2-(3-methoxypropyl)-2-methylspiro[1H-indene-3,4'-5H-1,3-oxazole]-5-yl]-5-methoxybenzonitrile.
| Compound Name | 3-[2'-amino-2-(3-methoxypropyl)-2-methylspiro[1H-indene-3,4'-5H-1,3-oxazole]-5-yl]-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 121276926 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-[2'-amino-2-(3-methoxypropyl)-2-methylspiro[1H-indene-3,4'-5H-1,3-oxazole]-5-yl]-5-methoxybenzonitrile |
| SMILES | COCCCC1(C)Cc2ccc(-c3cc(C#N)cc(OC)c3)cc2C12COC(N)=N2 |
| InChI | InChI=1S/C24H27N3O3/c1-23(7-4-8-28-2)13-18-6-5-17(12-21(18)24(23)15-30-22(26)27-24)19-9-16(14-25)10-20(11-19)29-3/h5-6,9-12H,4,7-8,13,15H2,1-3H3,(H2,26,27) |
| InChIKey | SOZCNMCSTIJHQF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|