C16H20O5 — CID 121277029
[(Z)-3-[(3aR,4S,6R,6aS)-6-ethenyl-3a,6a-dimethyl-1,3-dioxo-5,6-dihydro-4H-cyclopenta[c]furan-4-yl]prop-2-enyl] acetate (PubChem CID 121277029) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is [(Z)-3-[(3aR,4S,6R,6aS)-6-ethenyl-3a,6a-dimethyl-1,3-dioxo-5,6-dihydro-4H-cyclopenta[c]furan-4-yl]prop-2-enyl] acetate.
| Compound Name | [(Z)-3-[(3aR,4S,6R,6aS)-6-ethenyl-3a,6a-dimethyl-1,3-dioxo-5,6-dihydro-4H-cyclopenta[c]furan-4-yl]prop-2-enyl] acetate |
|---|---|
| PubChem CID | 121277029 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [(Z)-3-[(3aR,4S,6R,6aS)-6-ethenyl-3a,6a-dimethyl-1,3-dioxo-5,6-dihydro-4H-cyclopenta[c]furan-4-yl]prop-2-enyl] acetate |
| SMILES | C=C[C@H]1C[C@@H](/C=C\COC(C)=O)[C@@]2(C)C(=O)OC(=O)[C@@]12C |
| InChI | InChI=1S/C16H20O5/c1-5-11-9-12(7-6-8-20-10(2)17)16(4)14(19)21-13(18)15(11,16)3/h5-7,11-12H,1,8-9H2,2-4H3/b7-6-/t11-,12+,15+,16-/m0/s1 |
| InChIKey | CFSSVZBGDGQTNZ-GHJBTPDOSA-N |
| XLogP | 2.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|