C12H19F2N3 — CID 121277551
4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3-dien-3-yl]-2,3-dihydro-1H-triazole (PubChem CID 121277551) has the molecular formula C12H19F2N3 and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3-dien-3-yl]-2,3-dihydro-1H-triazole.
| Compound Name | 4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3-dien-3-yl]-2,3-dihydro-1H-triazole |
|---|---|
| PubChem CID | 121277551 |
| Molecular Formula | C12H19F2N3 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 4-(1,1-difluoropropyl)-5-[(3E)-4-methylhexa-1,3-dien-3-yl]-2,3-dihydro-1H-triazole |
| SMILES | C=C/C(C1=C(C(F)(F)CC)NNN1)=C(/C)CC |
| InChI | InChI=1S/C12H19F2N3/c1-5-8(4)9(6-2)10-11(16-17-15-10)12(13,14)7-3/h6,15-17H,2,5,7H2,1,3-4H3/b9-8+ |
| InChIKey | BAFCKJATXBHINB-CMDGGOBGSA-N |
| XLogP | 2.77 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|