C11H14N2O — CID 121277645
(2R)-2-ethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (PubChem CID 121277645) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (2R)-2-ethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one.
| Compound Name | (2R)-2-ethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 121277645 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (2R)-2-ethyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| SMILES | CC[C@@H]1CC(=O)Nc2ccccc2N1 |
| InChI | InChI=1S/C11H14N2O/c1-2-8-7-11(14)13-10-6-4-3-5-9(10)12-8/h3-6,8,12H,2,7H2,1H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | PMXHHDKSKLFUNV-MRVPVSSYSA-N |
| XLogP | 2.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |