C17H18N2 — CID 121277703
4-[4-(2-aminopropan-2-yl)phenyl]-3-methylbenzonitrile (PubChem CID 121277703) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-[4-(2-aminopropan-2-yl)phenyl]-3-methylbenzonitrile.
| Compound Name | 4-[4-(2-aminopropan-2-yl)phenyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 121277703 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-[4-(2-aminopropan-2-yl)phenyl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1ccc(C(C)(C)N)cc1 |
| InChI | InChI=1S/C17H18N2/c1-12-10-13(11-18)4-9-16(12)14-5-7-15(8-6-14)17(2,3)19/h4-10H,19H2,1-3H3 |
| InChIKey | BNEQLEPLXPQBNQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |