About 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline
5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline (PubChem CID 121277726) has the molecular formula C35H24N2
and a molecular weight of 472.59 g/mol. Its IUPAC name is 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline.
Molecular Properties
| Compound Name | 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline |
| PubChem CID | 121277726 |
| Molecular Formula | C35H24N2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline |
| SMILES | Cc1cc(C2=C3C=CC4=CC=CC5=CC=C(C=C2)C3C45)cc(-c2cc3cccnc3c3ncccc23)c1 |
| InChI | InChI=1S/C35H24N2/c1-21-17-26(28-13-11-24-10-9-22-5-2-6-23-12-14-29(28)33(24)32(22)23)19-27(18-21)31-20-25-7-3-15-36-34(25)35-30(31)8-4-16-37-35/h2-20,32-33H,1H3 |
| InChIKey | CYTBWDLDWASQBZ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline?
The IUPAC name of 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline (CID 121277726) is 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline.
What is the SMILES notation for 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline?
The canonical SMILES for 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline is Cc1cc(C2=C3C=CC4=CC=CC5=CC=C(C=C2)C3C45)cc(-c2cc3cccnc3c3ncccc23)c1.
What is the InChIKey of 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline?
The InChIKey is CYTBWDLDWASQBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H24N2/c1-21-17-26(28-13-11-24-10-9-22-5-2-6-23-12-14-29(28)33(24)32(22)23)19-27(18-21)31-20-25-7-3-15-36-34(25)35-30(31)8-4-16-37-35/h2-20,32-33H,1H3.
What are the key properties of 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline?
5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline has a molecular weight of 472.59 g/mol, XLogP of 8.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(10b,10c-dihydropyren-1-yl)-5-methylphenyl]-1,10-phenanthroline is sourced from PubChem (CID 121277726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).