C27H20F3N5O — CID 121277778
N-[[5-(2,6-difluorophenyl)-2-pyridinyl]methyl]-2-(12-fluoro-5,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaen-16-yl)acetamide (PubChem CID 121277778) has the molecular formula C27H20F3N5O and a molecular weight of 487.49 g/mol. Its IUPAC name is N-[[5-(2,6-difluorophenyl)-2-pyridinyl]methyl]-2-(12-fluoro-5,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaen-16-yl)acetamide.
| Compound Name | N-[[5-(2,6-difluorophenyl)-2-pyridinyl]methyl]-2-(12-fluoro-5,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaen-16-yl)acetamide |
|---|---|
| PubChem CID | 121277778 |
| Molecular Formula | C27H20F3N5O |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[[5-(2,6-difluorophenyl)-2-pyridinyl]methyl]-2-(12-fluoro-5,6,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,10(15),11,13-hexaen-16-yl)acetamide |
| SMILES | O=C(Cn1c2c(c3cc(F)ccc31)CCn1nccc1-2)NCc1ccc(-c2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C27H20F3N5O/c28-17-5-7-23-20(12-17)19-9-11-35-24(8-10-33-35)27(19)34(23)15-25(36)32-14-18-6-4-16(13-31-18)26-21(29)2-1-3-22(26)30/h1-8,10,12-13H,9,11,14-15H2,(H,32,36) |
| InChIKey | CFUNSXZSXDNVHZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|