About 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone
1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone (PubChem CID 121277849) has the molecular formula C12H18F3NO2
and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone |
| PubChem CID | 121277849 |
| Molecular Formula | C12H18F3NO2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)C1OCC2(CC2)CN1C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO2/c1-10(2,3)9-16(8(17)12(13,14)15)6-11(4-5-11)7-18-9/h9H,4-7H2,1-3H3 |
| InChIKey | BYQIJMBPAZXECX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone (CID 121277849) is 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone is CC(C)(C)C1OCC2(CC2)CN1C(=O)C(F)(F)F.
What is the InChIKey of 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone?
The InChIKey is BYQIJMBPAZXECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO2/c1-10(2,3)9-16(8(17)12(13,14)15)6-11(4-5-11)7-18-9/h9H,4-7H2,1-3H3.
What are the key properties of 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone?
1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone has a molecular weight of 265.27 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-tert-butyl-5-oxa-7-azaspiro[2.5]octan-7-yl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 121277849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).