C21H23N3O2 — CID 121277951
(4R)-4-methyl-6-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 121277951) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (4R)-4-methyl-6-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-4-methyl-6-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 121277951 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (4R)-4-methyl-6-(1,3,3-trimethyl-2-oxoindol-5-yl)-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C[C@@H]1CC(=O)Nc2cccc(-c3ccc4c(c3)C(C)(C)C(=O)N4C)c2N1 |
| InChI | InChI=1S/C21H23N3O2/c1-12-10-18(25)23-16-7-5-6-14(19(16)22-12)13-8-9-17-15(11-13)21(2,3)20(26)24(17)4/h5-9,11-12,22H,10H2,1-4H3,(H,23,25)/t12-/m1/s1 |
| InChIKey | OPGIGGUKTBYBTE-GFCCVEGCSA-N |
| XLogP | 3.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |