C19H20N2O — CID 121278052
(4R)-4-methyl-6-[(Z)-2-phenylprop-1-enyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 121278052) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (4R)-4-methyl-6-[(Z)-2-phenylprop-1-enyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-4-methyl-6-[(Z)-2-phenylprop-1-enyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 121278052 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (4R)-4-methyl-6-[(Z)-2-phenylprop-1-enyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C/C(=C/c1cccc2c1N[C@H](C)CC(=O)N2)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O/c1-13(15-7-4-3-5-8-15)11-16-9-6-10-17-19(16)20-14(2)12-18(22)21-17/h3-11,14,20H,12H2,1-2H3,(H,21,22)/b13-11-/t14-/m1/s1 |
| InChIKey | BACDLUMKKBRJFU-YBEMTRGBSA-N |
| XLogP | 4.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|