C19H17N3O — CID 121278131
4-[(E)-2-[(4R)-4-methyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]ethenyl]benzonitrile (PubChem CID 121278131) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-[(E)-2-[(4R)-4-methyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[(4R)-4-methyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 121278131 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-[(E)-2-[(4R)-4-methyl-2-oxo-1,3,4,5-tetrahydro-1,5-benzodiazepin-6-yl]ethenyl]benzonitrile |
| SMILES | C[C@@H]1CC(=O)Nc2cccc(/C=C/c3ccc(C#N)cc3)c2N1 |
| InChI | InChI=1S/C19H17N3O/c1-13-11-18(23)22-17-4-2-3-16(19(17)21-13)10-9-14-5-7-15(12-20)8-6-14/h2-10,13,21H,11H2,1H3,(H,22,23)/b10-9+/t13-/m1/s1 |
| InChIKey | ZERLCZDJHTXVMU-WTNCMQEWSA-N |
| XLogP | 3.87 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|