C21H19N3O2 — CID 121278153
(4R)-4-methyl-6-[(E)-2-[3-(1,3-oxazol-5-yl)phenyl]ethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 121278153) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is (4R)-4-methyl-6-[(E)-2-[3-(1,3-oxazol-5-yl)phenyl]ethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-4-methyl-6-[(E)-2-[3-(1,3-oxazol-5-yl)phenyl]ethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 121278153 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (4R)-4-methyl-6-[(E)-2-[3-(1,3-oxazol-5-yl)phenyl]ethenyl]-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C[C@@H]1CC(=O)Nc2cccc(/C=C/c3cccc(-c4cnco4)c3)c2N1 |
| InChI | InChI=1S/C21H19N3O2/c1-14-10-20(25)24-18-7-3-5-16(21(18)23-14)9-8-15-4-2-6-17(11-15)19-12-22-13-26-19/h2-9,11-14,23H,10H2,1H3,(H,24,25)/b9-8+/t14-/m1/s1 |
| InChIKey | LMMSNFQAGCYYJB-MYSGNRETSA-N |
| XLogP | 4.65 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|