C23H25F2N5O — CID 121278266
(4R)-6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(difluoromethyl)-2,3-dihydroindol-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 121278266) has the molecular formula C23H25F2N5O and a molecular weight of 425.48 g/mol. Its IUPAC name is (4R)-6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(difluoromethyl)-2,3-dihydroindol-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(difluoromethyl)-2,3-dihydroindol-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 121278266 |
| Molecular Formula | C23H25F2N5O |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (4R)-6-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(difluoromethyl)-2,3-dihydroindol-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C/N=C/C(=C\N)c1cc2c(cc1C(F)F)N(c1cccc3c1N[C@H](C)CC(=O)N3)CC2 |
| InChI | InChI=1S/C23H25F2N5O/c1-13-8-21(31)29-18-4-3-5-19(22(18)28-13)30-7-6-14-9-16(15(11-26)12-27-2)17(23(24)25)10-20(14)30/h3-5,9-13,23,28H,6-8,26H2,1-2H3,(H,29,31)/b15-11+,27-12+/t13-/m1/s1 |
| InChIKey | XINQQUJEFKMHIC-ZJXFUGQTSA-N |
| XLogP | 4.46 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|