About N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide
N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide (PubChem CID 121278982) has the molecular formula C12H8Cl2N6O2
and a molecular weight of 339.14 g/mol. Its IUPAC name is N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide.
Molecular Properties
| Compound Name | N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide |
| PubChem CID | 121278982 |
| Molecular Formula | C12H8Cl2N6O2 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)c1ccc(-n2cnc3c(Cl)nc(Cl)nc32)nc1 |
| InChI | InChI=1S/C12H8Cl2N6O2/c1-6(21)20(22)7-2-3-8(15-4-7)19-5-16-9-10(13)17-12(14)18-11(9)19/h2-5,22H,1H3 |
| InChIKey | UDGZPQNGWKGSPL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide?
The IUPAC name of N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide (CID 121278982) is N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide.
What is the SMILES notation for N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide?
The canonical SMILES for N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide is CC(=O)N(O)c1ccc(-n2cnc3c(Cl)nc(Cl)nc32)nc1.
What is the InChIKey of N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide?
The InChIKey is UDGZPQNGWKGSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N6O2/c1-6(21)20(22)7-2-3-8(15-4-7)19-5-16-9-10(13)17-12(14)18-11(9)19/h2-5,22H,1H3.
What are the key properties of N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide?
N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide has a molecular weight of 339.14 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,6-dichloropurin-9-yl)-3-pyridinyl]-N-hydroxyacetamide is sourced from PubChem (CID 121278982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).