About 2-(1,3-diazinan-2-yl)aniline
2-(1,3-diazinan-2-yl)aniline (PubChem CID 121279061) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-(1,3-diazinan-2-yl)aniline.
Molecular Properties
| Compound Name | 2-(1,3-diazinan-2-yl)aniline |
| PubChem CID | 121279061 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-(1,3-diazinan-2-yl)aniline |
| SMILES | Nc1ccccc1C1NCCCN1 |
| InChI | InChI=1S/C10H15N3/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10,12-13H,3,6-7,11H2 |
| InChIKey | RMRRURTXDCSFRG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-diazinan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-diazinan-2-yl)aniline?
The IUPAC name of 2-(1,3-diazinan-2-yl)aniline (CID 121279061) is 2-(1,3-diazinan-2-yl)aniline.
What is the SMILES notation for 2-(1,3-diazinan-2-yl)aniline?
The canonical SMILES for 2-(1,3-diazinan-2-yl)aniline is Nc1ccccc1C1NCCCN1.
What is the InChIKey of 2-(1,3-diazinan-2-yl)aniline?
The InChIKey is RMRRURTXDCSFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c11-9-5-2-1-4-8(9)10-12-6-3-7-13-10/h1-2,4-5,10,12-13H,3,6-7,11H2.
What are the key properties of 2-(1,3-diazinan-2-yl)aniline?
2-(1,3-diazinan-2-yl)aniline has a molecular weight of 177.25 g/mol, XLogP of 0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-diazinan-2-yl)aniline is sourced from PubChem (CID 121279061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).