C8H15IO2 — CID 121279197
(E,3R,4S)-6-iodo-4-methylhept-5-ene-3,4-diol (PubChem CID 121279197) has the molecular formula C8H15IO2 and a molecular weight of 270.11 g/mol. Its IUPAC name is (E,3R,4S)-6-iodo-4-methylhept-5-ene-3,4-diol.
| Compound Name | (E,3R,4S)-6-iodo-4-methylhept-5-ene-3,4-diol |
|---|---|
| PubChem CID | 121279197 |
| Molecular Formula | C8H15IO2 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | (E,3R,4S)-6-iodo-4-methylhept-5-ene-3,4-diol |
| SMILES | CC[C@@H](O)[C@@](C)(O)/C=C(\C)I |
| InChI | InChI=1S/C8H15IO2/c1-4-7(10)8(3,11)5-6(2)9/h5,7,10-11H,4H2,1-3H3/b6-5+/t7-,8+/m1/s1 |
| InChIKey | DKTRIQNYSCWTEA-KTERXBQFSA-N |
| XLogP | 1.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|