About N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide
N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide (PubChem CID 121279957) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide.
Molecular Properties
| Compound Name | N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide |
| PubChem CID | 121279957 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide |
| SMILES | C=C/C=C\C(=C)N/C(C)=N/CC |
| InChI | InChI=1S/C10H16N2/c1-5-7-8-9(3)12-10(4)11-6-2/h5,7-8H,1,3,6H2,2,4H3,(H,11,12)/b8-7- |
| InChIKey | GDABHRIBTKSASI-FPLPWBNLSA-N |
| XLogP | 2.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide?
The IUPAC name of N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide (CID 121279957) is N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide.
What is the SMILES notation for N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide?
The canonical SMILES for N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide is C=C/C=C\C(=C)N/C(C)=N/CC.
What is the InChIKey of N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide?
The InChIKey is GDABHRIBTKSASI-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H16N2/c1-5-7-8-9(3)12-10(4)11-6-2/h5,7-8H,1,3,6H2,2,4H3,(H,11,12)/b8-7-.
What are the key properties of N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide?
N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide has a molecular weight of 164.25 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N-[(3Z)-hexa-1,3,5-trien-2-yl]ethanimidamide is sourced from PubChem (CID 121279957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).