C32H33F3N8O2 — CID 121280360
N-[5-[[5-cyano-4-[7-(trifluoromethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 121280360) has the molecular formula C32H33F3N8O2 and a molecular weight of 618.66 g/mol. Its IUPAC name is N-[5-[[5-cyano-4-[7-(trifluoromethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[5-cyano-4-[7-(trifluoromethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 121280360 |
| Molecular Formula | C32H33F3N8O2 |
| Molecular Weight | 618.66 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | N-[5-[[5-cyano-4-[7-(trifluoromethyl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]pyrimidin-2-yl]amino]-2-[2-(dimethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(C#N)c(-c3cn4c5c(c(C(F)(F)F)ccc35)CCC4)n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C32H33F3N8O2/c1-6-28(44)38-24-14-25(27(45-5)15-26(24)42(4)13-12-41(2)3)39-31-37-17-19(16-36)29(40-31)22-18-43-11-7-8-21-23(32(33,34)35)10-9-20(22)30(21)43/h6,9-10,14-15,17-18H,1,7-8,11-13H2,2-5H3,(H,38,44)(H,37,39,40) |
| InChIKey | HXMZORZRLMOJNL-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|