About US10202375, Example 21
US10202375, Example 21 (PubChem CID 121280703) has the molecular formula C23H15F3N8O
and a molecular weight of 476.40 g/mol. Its IUPAC name is N-(5-pyrazin-2-yl-2-pyridinyl)-2-[4-[2-(trifluoromethyl)-4-pyridinyl]pyrrolo[2,3-d]pyrimidin-7-yl]acetamide.
Molecular Properties
| Compound Name | US10202375, Example 21 |
| PubChem CID | 121280703 |
| Molecular Formula | C23H15F3N8O |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-(5-pyrazin-2-yl-2-pyridinyl)-2-[4-[2-(trifluoromethyl)-4-pyridinyl]pyrrolo[2,3-d]pyrimidin-7-yl]acetamide |
| SMILES | C1=CC(=NC=C1C2=NC=CN=C2)NC(=O)CN3C=CC4=C(N=CN=C43)C5=CC(=NC=C5)C(F)(F)F |
| InChI | InChI=1S/C23H15F3N8O/c24-23(25,26)18-9-14(3-5-29-18)21-16-4-8-34(22(16)32-13-31-21)12-20(35)33-19-2-1-15(10-30-19)17-11-27-6-7-28-17/h1-11,13H,12H2,(H,30,33,35) |
| InChIKey | OFVZKOSLNUNKOX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | 727 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze US10202375, Example 21 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10202375, Example 21?
The IUPAC name of US10202375, Example 21 (CID 121280703) is N-(5-pyrazin-2-yl-2-pyridinyl)-2-[4-[2-(trifluoromethyl)-4-pyridinyl]pyrrolo[2,3-d]pyrimidin-7-yl]acetamide.
What is the SMILES notation for US10202375, Example 21?
The canonical SMILES for US10202375, Example 21 is C1=CC(=NC=C1C2=NC=CN=C2)NC(=O)CN3C=CC4=C(N=CN=C43)C5=CC(=NC=C5)C(F)(F)F.
What is the InChIKey of US10202375, Example 21?
The InChIKey is OFVZKOSLNUNKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F3N8O/c24-23(25,26)18-9-14(3-5-29-18)21-16-4-8-34(22(16)32-13-31-21)12-20(35)33-19-2-1-15(10-30-19)17-11-27-6-7-28-17/h1-11,13H,12H2,(H,30,33,35).
What are the key properties of US10202375, Example 21?
US10202375, Example 21 has a molecular weight of 476.40 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for US10202375, Example 21 is sourced from PubChem (CID 121280703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).