About 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane
2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane (PubChem CID 121281189) has the molecular formula C13H12Cl2F2O
and a molecular weight of 293.14 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane.
Molecular Properties
| Compound Name | 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane |
| PubChem CID | 121281189 |
| Molecular Formula | C13H12Cl2F2O |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane |
| SMILES | FC1(F)CCC2(CC1)OC2c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl2F2O/c14-9-3-1-2-8(10(9)15)11-12(18-11)4-6-13(16,17)7-5-12/h1-3,11H,4-7H2 |
| InChIKey | AXGUOIOTONQRCX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane?
The IUPAC name of 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane (CID 121281189) is 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane.
What is the SMILES notation for 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane?
The canonical SMILES for 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane is FC1(F)CCC2(CC1)OC2c1cccc(Cl)c1Cl.
What is the InChIKey of 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane?
The InChIKey is AXGUOIOTONQRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2F2O/c14-9-3-1-2-8(10(9)15)11-12(18-11)4-6-13(16,17)7-5-12/h1-3,11H,4-7H2.
What are the key properties of 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane?
2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane has a molecular weight of 293.14 g/mol, XLogP of 5.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichlorophenyl)-6,6-difluoro-1-oxaspiro[2.5]octane is sourced from PubChem (CID 121281189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).