C10H13N5O — CID 121282067
6-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine (PubChem CID 121282067) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine.
| Compound Name | 6-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 121282067 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine |
| SMILES | Nc1nc2ccc(C3CCOC3)c(N)n2n1 |
| InChI | InChI=1S/C10H13N5O/c11-9-7(6-3-4-16-5-6)1-2-8-13-10(12)14-15(8)9/h1-2,6H,3-5,11H2,(H2,12,14) |
| InChIKey | HHKYVXKWTIHTRQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |