About fluoren-1-one;1-phenylethanone
fluoren-1-one;1-phenylethanone (PubChem CID 121282266) has the molecular formula C21H16O2
and a molecular weight of 300.36 g/mol. Its IUPAC name is fluoren-1-one;1-phenylethanone.
Molecular Properties
| Compound Name | fluoren-1-one;1-phenylethanone |
| PubChem CID | 121282266 |
| Molecular Formula | C21H16O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | fluoren-1-one;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=C1C=CC=C2C1=Cc1ccccc12 |
| InChI | InChI=1S/C13H8O.C8H8O/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-7(9)8-5-3-2-4-6-8/h1-8H;2-6H,1H3 |
| InChIKey | CAYDXRWCTAIBQP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoren-1-one;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoren-1-one;1-phenylethanone?
The IUPAC name of fluoren-1-one;1-phenylethanone (CID 121282266) is fluoren-1-one;1-phenylethanone.
What is the SMILES notation for fluoren-1-one;1-phenylethanone?
The canonical SMILES for fluoren-1-one;1-phenylethanone is CC(=O)c1ccccc1.O=C1C=CC=C2C1=Cc1ccccc12.
What is the InChIKey of fluoren-1-one;1-phenylethanone?
The InChIKey is CAYDXRWCTAIBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O.C8H8O/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;1-7(9)8-5-3-2-4-6-8/h1-8H;2-6H,1H3.
What are the key properties of fluoren-1-one;1-phenylethanone?
fluoren-1-one;1-phenylethanone has a molecular weight of 300.36 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoren-1-one;1-phenylethanone is sourced from PubChem (CID 121282266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).